C18H19F2NO3S — CID 129039648
O-methyl N-[5-(difluoromethyl)-2-[(2,4-dimethylphenoxy)methyl]phenyl]-N-hydroxycarbamothioate (PubChem CID 129039648) has the molecular formula C18H19F2NO3S and a molecular weight of 367.42 g/mol. Its IUPAC name is O-methyl N-[5-(difluoromethyl)-2-[(2,4-dimethylphenoxy)methyl]phenyl]-N-hydroxycarbamothioate.
| Compound Name | O-methyl N-[5-(difluoromethyl)-2-[(2,4-dimethylphenoxy)methyl]phenyl]-N-hydroxycarbamothioate |
|---|---|
| PubChem CID | 129039648 |
| Molecular Formula | C18H19F2NO3S |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | O-methyl N-[5-(difluoromethyl)-2-[(2,4-dimethylphenoxy)methyl]phenyl]-N-hydroxycarbamothioate |
| SMILES | COC(=S)N(O)c1cc(C(F)F)ccc1COc1ccc(C)cc1C |
| InChI | InChI=1S/C18H19F2NO3S/c1-11-4-7-16(12(2)8-11)24-10-14-6-5-13(17(19)20)9-15(14)21(22)18(25)23-3/h4-9,17,22H,10H2,1-3H3 |
| InChIKey | ZDUBUBOLOODVBJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|