C21H27NO3S — CID 126587421
O-methyl N-[2-[(4-ethyl-2-methylphenoxy)methyl]-4-propan-2-ylphenyl]-N-hydroxycarbamothioate (PubChem CID 126587421) has the molecular formula C21H27NO3S and a molecular weight of 373.52 g/mol. Its IUPAC name is O-methyl N-[2-[(4-ethyl-2-methylphenoxy)methyl]-4-propan-2-ylphenyl]-N-hydroxycarbamothioate.
| Compound Name | O-methyl N-[2-[(4-ethyl-2-methylphenoxy)methyl]-4-propan-2-ylphenyl]-N-hydroxycarbamothioate |
|---|---|
| PubChem CID | 126587421 |
| Molecular Formula | C21H27NO3S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | O-methyl N-[2-[(4-ethyl-2-methylphenoxy)methyl]-4-propan-2-ylphenyl]-N-hydroxycarbamothioate |
| SMILES | CCc1ccc(OCc2cc(C(C)C)ccc2N(O)C(=S)OC)c(C)c1 |
| InChI | InChI=1S/C21H27NO3S/c1-6-16-7-10-20(15(4)11-16)25-13-18-12-17(14(2)3)8-9-19(18)22(23)21(26)24-5/h7-12,14,23H,6,13H2,1-5H3 |
| InChIKey | YBUAVXPHLBKHFC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|