C17H17FO3S — CID 122646159
[2-[(2,4-dimethylphenoxy)methyl]-3-fluorophenyl] methylsulfanylformate (PubChem CID 122646159) has the molecular formula C17H17FO3S and a molecular weight of 320.38 g/mol. Its IUPAC name is [2-[(2,4-dimethylphenoxy)methyl]-3-fluorophenyl] methylsulfanylformate.
| Compound Name | [2-[(2,4-dimethylphenoxy)methyl]-3-fluorophenyl] methylsulfanylformate |
|---|---|
| PubChem CID | 122646159 |
| Molecular Formula | C17H17FO3S |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | [2-[(2,4-dimethylphenoxy)methyl]-3-fluorophenyl] methylsulfanylformate |
| SMILES | CSC(=O)Oc1cccc(F)c1COc1ccc(C)cc1C |
| InChI | InChI=1S/C17H17FO3S/c1-11-7-8-15(12(2)9-11)20-10-13-14(18)5-4-6-16(13)21-17(19)22-3/h4-9H,10H2,1-3H3 |
| InChIKey | DMCIHJWWKWMSKZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|