C19H21FO3S — CID 122649133
[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-fluorophenyl] methylsulfanylformate (PubChem CID 122649133) has the molecular formula C19H21FO3S and a molecular weight of 348.44 g/mol. Its IUPAC name is [2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-fluorophenyl] methylsulfanylformate.
| Compound Name | [2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-fluorophenyl] methylsulfanylformate |
|---|---|
| PubChem CID | 122649133 |
| Molecular Formula | C19H21FO3S |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | [2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-fluorophenyl] methylsulfanylformate |
| SMILES | CCc1cc(C)c(OCc2c(F)cccc2OC(=O)SC)cc1C |
| InChI | InChI=1S/C19H21FO3S/c1-5-14-9-13(3)18(10-12(14)2)22-11-15-16(20)7-6-8-17(15)23-19(21)24-4/h6-10H,5,11H2,1-4H3 |
| InChIKey | VKWKLEIFAQKETD-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|