C20H21FO4 — CID 126588290
methyl 2-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-fluorophenyl]-2-oxoacetate (PubChem CID 126588290) has the molecular formula C20H21FO4 and a molecular weight of 344.38 g/mol. Its IUPAC name is methyl 2-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-fluorophenyl]-2-oxoacetate.
| Compound Name | methyl 2-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-fluorophenyl]-2-oxoacetate |
|---|---|
| PubChem CID | 126588290 |
| Molecular Formula | C20H21FO4 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | methyl 2-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-fluorophenyl]-2-oxoacetate |
| SMILES | CCc1cc(C)c(OCc2c(F)cccc2C(=O)C(=O)OC)cc1C |
| InChI | InChI=1S/C20H21FO4/c1-5-14-9-13(3)18(10-12(14)2)25-11-16-15(7-6-8-17(16)21)19(22)20(23)24-4/h6-10H,5,11H2,1-4H3 |
| InChIKey | ZFAMHYRHBBHSQE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|