C18H20O3S — CID 122646282
[2-[(2,4,5-trimethylphenoxy)methyl]phenyl] methylsulfanylformate (PubChem CID 122646282) has the molecular formula C18H20O3S and a molecular weight of 316.42 g/mol. Its IUPAC name is [2-[(2,4,5-trimethylphenoxy)methyl]phenyl] methylsulfanylformate.
| Compound Name | [2-[(2,4,5-trimethylphenoxy)methyl]phenyl] methylsulfanylformate |
|---|---|
| PubChem CID | 122646282 |
| Molecular Formula | C18H20O3S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | [2-[(2,4,5-trimethylphenoxy)methyl]phenyl] methylsulfanylformate |
| SMILES | CSC(=O)Oc1ccccc1COc1cc(C)c(C)cc1C |
| InChI | InChI=1S/C18H20O3S/c1-12-9-14(3)17(10-13(12)2)20-11-15-7-5-6-8-16(15)21-18(19)22-4/h5-10H,11H2,1-4H3 |
| InChIKey | XQUMVBJVVZEUFE-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|