C19H22O3S — CID 122646332
[3-(sulfanylmethyl)-2-[(2,4,5-trimethylphenoxy)methyl]phenyl] acetate (PubChem CID 122646332) has the molecular formula C19H22O3S and a molecular weight of 330.45 g/mol. Its IUPAC name is [3-(sulfanylmethyl)-2-[(2,4,5-trimethylphenoxy)methyl]phenyl] acetate.
| Compound Name | [3-(sulfanylmethyl)-2-[(2,4,5-trimethylphenoxy)methyl]phenyl] acetate |
|---|---|
| PubChem CID | 122646332 |
| Molecular Formula | C19H22O3S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | [3-(sulfanylmethyl)-2-[(2,4,5-trimethylphenoxy)methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(CS)c1COc1cc(C)c(C)cc1C |
| InChI | InChI=1S/C19H22O3S/c1-12-8-14(3)19(9-13(12)2)21-10-17-16(11-23)6-5-7-18(17)22-15(4)20/h5-9,23H,10-11H2,1-4H3 |
| InChIKey | HIYSEPKDVNAVQW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|