C19H21ClO2 — CID 121367485
3-ethyl-2-[(2,4,5-trimethylphenoxy)methyl]benzoyl chloride (PubChem CID 121367485) has the molecular formula C19H21ClO2 and a molecular weight of 316.83 g/mol. Its IUPAC name is 3-ethyl-2-[(2,4,5-trimethylphenoxy)methyl]benzoyl chloride.
| Compound Name | 3-ethyl-2-[(2,4,5-trimethylphenoxy)methyl]benzoyl chloride |
|---|---|
| PubChem CID | 121367485 |
| Molecular Formula | C19H21ClO2 |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 3-ethyl-2-[(2,4,5-trimethylphenoxy)methyl]benzoyl chloride |
| SMILES | CCc1cccc(C(=O)Cl)c1COc1cc(C)c(C)cc1C |
| InChI | InChI=1S/C19H21ClO2/c1-5-15-7-6-8-16(19(20)21)17(15)11-22-18-10-13(3)12(2)9-14(18)4/h6-10H,5,11H2,1-4H3 |
| InChIKey | QZWDVQNGWKIVDV-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|