3-ethyl-2-[(2,4,5-trimethylphenoxy)methyl]benzoyl chloride

C19H21ClO2 — CID 121367485

IUPAC3-ethyl-2-[(2,4,5-trimethylphenoxy)methyl]benzoyl chloride
SMILESCCc1cccc(C(=O)Cl)c1COc1cc(C)c(C)cc1C
InChIInChI=1S/C19H21ClO2/c1-5-15-7-6-8-16(19(20)21)17(15)11-22-18-10-13(3)12(2)9-14(18)4/h6-10H,5,11H2,1-4H3
InChIKeyQZWDVQNGWKIVDV-UHFFFAOYSA-N
MW316.83 g/mol
LogP5.13
Rot. Bonds5

About 3-ethyl-2-[(2,4,5-trimethylphenoxy)methyl]benzoyl chloride

3-ethyl-2-[(2,4,5-trimethylphenoxy)methyl]benzoyl chloride (PubChem CID 121367485) has the molecular formula C19H21ClO2 and a molecular weight of 316.83 g/mol. Its IUPAC name is 3-ethyl-2-[(2,4,5-trimethylphenoxy)methyl]benzoyl chloride.

Molecular Properties

Compound Name3-ethyl-2-[(2,4,5-trimethylphenoxy)methyl]benzoyl chloride
PubChem CID121367485
Molecular FormulaC19H21ClO2
Molecular Weight316.83 g/mol
Exact Mass316.12
IUPAC Name3-ethyl-2-[(2,4,5-trimethylphenoxy)methyl]benzoyl chloride
SMILESCCc1cccc(C(=O)Cl)c1COc1cc(C)c(C)cc1C
InChIInChI=1S/C19H21ClO2/c1-5-15-7-6-8-16(19(20)21)17(15)11-22-18-10-13(3)12(2)9-14(18)4/h6-10H,5,11H2,1-4H3
InChIKeyQZWDVQNGWKIVDV-UHFFFAOYSA-N
XLogP5.13
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500316.83
LogP ≤ 55.13
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 3-ethyl-2-[(2,4,5-trimethylphenoxy)methyl]benzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-ethyl-2-[(2,4,5-trimethylphenoxy)methyl]benzoyl chloride?
The IUPAC name of 3-ethyl-2-[(2,4,5-trimethylphenoxy)methyl]benzoyl chloride (CID 121367485) is 3-ethyl-2-[(2,4,5-trimethylphenoxy)methyl]benzoyl chloride.
What is the SMILES notation for 3-ethyl-2-[(2,4,5-trimethylphenoxy)methyl]benzoyl chloride?
The canonical SMILES for 3-ethyl-2-[(2,4,5-trimethylphenoxy)methyl]benzoyl chloride is CCc1cccc(C(=O)Cl)c1COc1cc(C)c(C)cc1C.
What is the InChIKey of 3-ethyl-2-[(2,4,5-trimethylphenoxy)methyl]benzoyl chloride?
The InChIKey is QZWDVQNGWKIVDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21ClO2/c1-5-15-7-6-8-16(19(20)21)17(15)11-22-18-10-13(3)12(2)9-14(18)4/h6-10H,5,11H2,1-4H3.
What are the key properties of 3-ethyl-2-[(2,4,5-trimethylphenoxy)methyl]benzoyl chloride?
3-ethyl-2-[(2,4,5-trimethylphenoxy)methyl]benzoyl chloride has a molecular weight of 316.83 g/mol, XLogP of 5.13, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2-[(2,4,5-trimethylphenoxy)methyl]benzoyl chloride is sourced from PubChem (CID 121367485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).