methyl 2-[(2,4-dimethylphenoxy)methyl]-3-ethylbenzoate

C19H22O3 — CID 121367533

IUPACmethyl 2-[(2,4-dimethylphenoxy)methyl]-3-ethylbenzoate
SMILESCCc1cccc(C(=O)OC)c1COc1ccc(C)cc1C
InChIInChI=1S/C19H22O3/c1-5-15-7-6-8-16(19(20)21-4)17(15)12-22-18-10-9-13(2)11-14(18)3/h6-11H,5,12H2,1-4H3
InChIKeySLNSTEOTIGMLHE-UHFFFAOYSA-N
MW298.38 g/mol
LogP4.23
Rot. Bonds5

About methyl 2-[(2,4-dimethylphenoxy)methyl]-3-ethylbenzoate

methyl 2-[(2,4-dimethylphenoxy)methyl]-3-ethylbenzoate (PubChem CID 121367533) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is methyl 2-[(2,4-dimethylphenoxy)methyl]-3-ethylbenzoate.

Molecular Properties

Compound Namemethyl 2-[(2,4-dimethylphenoxy)methyl]-3-ethylbenzoate
PubChem CID121367533
Molecular FormulaC19H22O3
Molecular Weight298.38 g/mol
Exact Mass298.16
IUPAC Namemethyl 2-[(2,4-dimethylphenoxy)methyl]-3-ethylbenzoate
SMILESCCc1cccc(C(=O)OC)c1COc1ccc(C)cc1C
InChIInChI=1S/C19H22O3/c1-5-15-7-6-8-16(19(20)21-4)17(15)12-22-18-10-9-13(2)11-14(18)3/h6-11H,5,12H2,1-4H3
InChIKeySLNSTEOTIGMLHE-UHFFFAOYSA-N
XLogP4.23
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.38
LogP ≤ 54.23
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2-[(2,4-dimethylphenoxy)methyl]-3-ethylbenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(2,4-dimethylphenoxy)methyl]-3-ethylbenzoate?
The IUPAC name of methyl 2-[(2,4-dimethylphenoxy)methyl]-3-ethylbenzoate (CID 121367533) is methyl 2-[(2,4-dimethylphenoxy)methyl]-3-ethylbenzoate.
What is the SMILES notation for methyl 2-[(2,4-dimethylphenoxy)methyl]-3-ethylbenzoate?
The canonical SMILES for methyl 2-[(2,4-dimethylphenoxy)methyl]-3-ethylbenzoate is CCc1cccc(C(=O)OC)c1COc1ccc(C)cc1C.
What is the InChIKey of methyl 2-[(2,4-dimethylphenoxy)methyl]-3-ethylbenzoate?
The InChIKey is SLNSTEOTIGMLHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22O3/c1-5-15-7-6-8-16(19(20)21-4)17(15)12-22-18-10-9-13(2)11-14(18)3/h6-11H,5,12H2,1-4H3.
What are the key properties of methyl 2-[(2,4-dimethylphenoxy)methyl]-3-ethylbenzoate?
methyl 2-[(2,4-dimethylphenoxy)methyl]-3-ethylbenzoate has a molecular weight of 298.38 g/mol, XLogP of 4.23, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2,4-dimethylphenoxy)methyl]-3-ethylbenzoate is sourced from PubChem (CID 121367533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).