C20H22O3 — CID 121367539
methyl 3-cyclopropyl-2-[(2,4-dimethylphenoxy)methyl]benzoate (PubChem CID 121367539) has the molecular formula C20H22O3 and a molecular weight of 310.39 g/mol. Its IUPAC name is methyl 3-cyclopropyl-2-[(2,4-dimethylphenoxy)methyl]benzoate.
| Compound Name | methyl 3-cyclopropyl-2-[(2,4-dimethylphenoxy)methyl]benzoate |
|---|---|
| PubChem CID | 121367539 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | methyl 3-cyclopropyl-2-[(2,4-dimethylphenoxy)methyl]benzoate |
| SMILES | COC(=O)c1cccc(C2CC2)c1COc1ccc(C)cc1C |
| InChI | InChI=1S/C20H22O3/c1-13-7-10-19(14(2)11-13)23-12-18-16(15-8-9-15)5-4-6-17(18)20(21)22-3/h4-7,10-11,15H,8-9,12H2,1-3H3 |
| InChIKey | AZGPXMZPUZBPPI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |