C22H26O2S — CID 122626928
S-[3-cyclopropyl-2-[(4-ethyl-2-methylphenoxy)methyl]phenyl] propanethioate (PubChem CID 122626928) has the molecular formula C22H26O2S and a molecular weight of 354.52 g/mol. Its IUPAC name is S-[3-cyclopropyl-2-[(4-ethyl-2-methylphenoxy)methyl]phenyl] propanethioate.
| Compound Name | S-[3-cyclopropyl-2-[(4-ethyl-2-methylphenoxy)methyl]phenyl] propanethioate |
|---|---|
| PubChem CID | 122626928 |
| Molecular Formula | C22H26O2S |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | S-[3-cyclopropyl-2-[(4-ethyl-2-methylphenoxy)methyl]phenyl] propanethioate |
| SMILES | CCC(=O)Sc1cccc(C2CC2)c1COc1ccc(CC)cc1C |
| InChI | InChI=1S/C22H26O2S/c1-4-16-9-12-20(15(3)13-16)24-14-19-18(17-10-11-17)7-6-8-21(19)25-22(23)5-2/h6-9,12-13,17H,4-5,10-11,14H2,1-3H3 |
| InChIKey | IUWVZXVESIAUPX-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|