C20H25NO2S — CID 122626847
S-[3-ethyl-2-[(4-ethyl-2-methylphenoxy)methyl]phenyl] N-methylcarbamothioate (PubChem CID 122626847) has the molecular formula C20H25NO2S and a molecular weight of 343.49 g/mol. Its IUPAC name is S-[3-ethyl-2-[(4-ethyl-2-methylphenoxy)methyl]phenyl] N-methylcarbamothioate.
| Compound Name | S-[3-ethyl-2-[(4-ethyl-2-methylphenoxy)methyl]phenyl] N-methylcarbamothioate |
|---|---|
| PubChem CID | 122626847 |
| Molecular Formula | C20H25NO2S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | S-[3-ethyl-2-[(4-ethyl-2-methylphenoxy)methyl]phenyl] N-methylcarbamothioate |
| SMILES | CCc1ccc(OCc2c(CC)cccc2SC(=O)NC)c(C)c1 |
| InChI | InChI=1S/C20H25NO2S/c1-5-15-10-11-18(14(3)12-15)23-13-17-16(6-2)8-7-9-19(17)24-20(22)21-4/h7-12H,5-6,13H2,1-4H3,(H,21,22) |
| InChIKey | REZAPAOLSBVKCI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|