C17H18INO2S — CID 122646196
S-[2-[(2,4-dimethylphenoxy)methyl]-3-iodophenyl] N-methylcarbamothioate (PubChem CID 122646196) has the molecular formula C17H18INO2S and a molecular weight of 427.31 g/mol. Its IUPAC name is S-[2-[(2,4-dimethylphenoxy)methyl]-3-iodophenyl] N-methylcarbamothioate.
| Compound Name | S-[2-[(2,4-dimethylphenoxy)methyl]-3-iodophenyl] N-methylcarbamothioate |
|---|---|
| PubChem CID | 122646196 |
| Molecular Formula | C17H18INO2S |
| Molecular Weight | 427.31 g/mol |
| Exact Mass | 427.01 |
| IUPAC Name | S-[2-[(2,4-dimethylphenoxy)methyl]-3-iodophenyl] N-methylcarbamothioate |
| SMILES | CNC(=O)Sc1cccc(I)c1COc1ccc(C)cc1C |
| InChI | InChI=1S/C17H18INO2S/c1-11-7-8-15(12(2)9-11)21-10-13-14(18)5-4-6-16(13)22-17(20)19-3/h4-9H,10H2,1-3H3,(H,19,20) |
| InChIKey | SFPWTURBUAOMGD-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.31 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|