C17H17IO2S — CID 122646219
S-[2-[(2,4-dimethylphenoxy)methyl]-3-iodophenyl] ethanethioate (PubChem CID 122646219) has the molecular formula C17H17IO2S and a molecular weight of 412.29 g/mol. Its IUPAC name is S-[2-[(2,4-dimethylphenoxy)methyl]-3-iodophenyl] ethanethioate.
| Compound Name | S-[2-[(2,4-dimethylphenoxy)methyl]-3-iodophenyl] ethanethioate |
|---|---|
| PubChem CID | 122646219 |
| Molecular Formula | C17H17IO2S |
| Molecular Weight | 412.29 g/mol |
| Exact Mass | 412.00 |
| IUPAC Name | S-[2-[(2,4-dimethylphenoxy)methyl]-3-iodophenyl] ethanethioate |
| SMILES | CC(=O)Sc1cccc(I)c1COc1ccc(C)cc1C |
| InChI | InChI=1S/C17H17IO2S/c1-11-7-8-16(12(2)9-11)20-10-14-15(18)5-4-6-17(14)21-13(3)19/h4-9H,10H2,1-3H3 |
| InChIKey | OQOZJUUORUGUOX-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.29 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|