C19H22O4S — CID 122646167
[2-[(2,4-dimethylphenoxy)methyl]-3-ethoxyphenyl] methylsulfanylformate (PubChem CID 122646167) has the molecular formula C19H22O4S and a molecular weight of 346.45 g/mol. Its IUPAC name is [2-[(2,4-dimethylphenoxy)methyl]-3-ethoxyphenyl] methylsulfanylformate.
| Compound Name | [2-[(2,4-dimethylphenoxy)methyl]-3-ethoxyphenyl] methylsulfanylformate |
|---|---|
| PubChem CID | 122646167 |
| Molecular Formula | C19H22O4S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | [2-[(2,4-dimethylphenoxy)methyl]-3-ethoxyphenyl] methylsulfanylformate |
| SMILES | CCOc1cccc(OC(=O)SC)c1COc1ccc(C)cc1C |
| InChI | InChI=1S/C19H22O4S/c1-5-21-17-7-6-8-18(23-19(20)24-4)15(17)12-22-16-10-9-13(2)11-14(16)3/h6-11H,5,12H2,1-4H3 |
| InChIKey | HZQVJULCWWSEST-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|