C20H23BrO4 — CID 122646090
[2-[(2-bromo-4,5-dimethylphenoxy)methyl]-3-ethoxyphenyl] propanoate (PubChem CID 122646090) has the molecular formula C20H23BrO4 and a molecular weight of 407.30 g/mol. Its IUPAC name is [2-[(2-bromo-4,5-dimethylphenoxy)methyl]-3-ethoxyphenyl] propanoate.
| Compound Name | [2-[(2-bromo-4,5-dimethylphenoxy)methyl]-3-ethoxyphenyl] propanoate |
|---|---|
| PubChem CID | 122646090 |
| Molecular Formula | C20H23BrO4 |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | [2-[(2-bromo-4,5-dimethylphenoxy)methyl]-3-ethoxyphenyl] propanoate |
| SMILES | CCOc1cccc(OC(=O)CC)c1COc1cc(C)c(C)cc1Br |
| InChI | InChI=1S/C20H23BrO4/c1-5-20(22)25-18-9-7-8-17(23-6-2)15(18)12-24-19-11-14(4)13(3)10-16(19)21/h7-11H,5-6,12H2,1-4H3 |
| InChIKey | BQAMXBMWLUOLDE-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|