C21H24F2O3 — CID 122646112
[2-[[2-(difluoromethyl)-4,5-dimethylphenoxy]methyl]-3-ethylphenyl] propanoate (PubChem CID 122646112) has the molecular formula C21H24F2O3 and a molecular weight of 362.42 g/mol. Its IUPAC name is [2-[[2-(difluoromethyl)-4,5-dimethylphenoxy]methyl]-3-ethylphenyl] propanoate.
| Compound Name | [2-[[2-(difluoromethyl)-4,5-dimethylphenoxy]methyl]-3-ethylphenyl] propanoate |
|---|---|
| PubChem CID | 122646112 |
| Molecular Formula | C21H24F2O3 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | [2-[[2-(difluoromethyl)-4,5-dimethylphenoxy]methyl]-3-ethylphenyl] propanoate |
| SMILES | CCC(=O)Oc1cccc(CC)c1COc1cc(C)c(C)cc1C(F)F |
| InChI | InChI=1S/C21H24F2O3/c1-5-15-8-7-9-18(26-20(24)6-2)17(15)12-25-19-11-14(4)13(3)10-16(19)21(22)23/h7-11,21H,5-6,12H2,1-4H3 |
| InChIKey | GZFJIFXJGCAKGT-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|