C21H23F3O3 — CID 122646125
[2-[[4,5-dimethyl-2-(trifluoromethyl)phenoxy]methyl]-3-ethylphenyl] propanoate (PubChem CID 122646125) has the molecular formula C21H23F3O3 and a molecular weight of 380.41 g/mol. Its IUPAC name is [2-[[4,5-dimethyl-2-(trifluoromethyl)phenoxy]methyl]-3-ethylphenyl] propanoate.
| Compound Name | [2-[[4,5-dimethyl-2-(trifluoromethyl)phenoxy]methyl]-3-ethylphenyl] propanoate |
|---|---|
| PubChem CID | 122646125 |
| Molecular Formula | C21H23F3O3 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | [2-[[4,5-dimethyl-2-(trifluoromethyl)phenoxy]methyl]-3-ethylphenyl] propanoate |
| SMILES | CCC(=O)Oc1cccc(CC)c1COc1cc(C)c(C)cc1C(F)(F)F |
| InChI | InChI=1S/C21H23F3O3/c1-5-15-8-7-9-18(27-20(25)6-2)16(15)12-26-19-11-14(4)13(3)10-17(19)21(22,23)24/h7-11H,5-6,12H2,1-4H3 |
| InChIKey | PDVWIZHNVMNVJZ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|