C19H18F3IO3 — CID 122626749
[2-[[4-ethyl-2-(trifluoromethyl)phenoxy]methyl]-3-iodophenyl] propanoate (PubChem CID 122626749) has the molecular formula C19H18F3IO3 and a molecular weight of 478.25 g/mol. Its IUPAC name is [2-[[4-ethyl-2-(trifluoromethyl)phenoxy]methyl]-3-iodophenyl] propanoate.
| Compound Name | [2-[[4-ethyl-2-(trifluoromethyl)phenoxy]methyl]-3-iodophenyl] propanoate |
|---|---|
| PubChem CID | 122626749 |
| Molecular Formula | C19H18F3IO3 |
| Molecular Weight | 478.25 g/mol |
| Exact Mass | 478.03 |
| IUPAC Name | [2-[[4-ethyl-2-(trifluoromethyl)phenoxy]methyl]-3-iodophenyl] propanoate |
| SMILES | CCC(=O)Oc1cccc(I)c1COc1ccc(CC)cc1C(F)(F)F |
| InChI | InChI=1S/C19H18F3IO3/c1-3-12-8-9-17(14(10-12)19(20,21)22)25-11-13-15(23)6-5-7-16(13)26-18(24)4-2/h5-10H,3-4,11H2,1-2H3 |
| InChIKey | BFKFABQTLAGYJU-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.25 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|