C22H25F3O3 — CID 122649810
[2-[(2,4-diethyl-5-methylphenoxy)methyl]-3-(trifluoromethyl)phenyl] propanoate (PubChem CID 122649810) has the molecular formula C22H25F3O3 and a molecular weight of 394.43 g/mol. Its IUPAC name is [2-[(2,4-diethyl-5-methylphenoxy)methyl]-3-(trifluoromethyl)phenyl] propanoate.
| Compound Name | [2-[(2,4-diethyl-5-methylphenoxy)methyl]-3-(trifluoromethyl)phenyl] propanoate |
|---|---|
| PubChem CID | 122649810 |
| Molecular Formula | C22H25F3O3 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | [2-[(2,4-diethyl-5-methylphenoxy)methyl]-3-(trifluoromethyl)phenyl] propanoate |
| SMILES | CCC(=O)Oc1cccc(C(F)(F)F)c1COc1cc(C)c(CC)cc1CC |
| InChI | InChI=1S/C22H25F3O3/c1-5-15-12-16(6-2)20(11-14(15)4)27-13-17-18(22(23,24)25)9-8-10-19(17)28-21(26)7-3/h8-12H,5-7,13H2,1-4H3 |
| InChIKey | BLWJGUYUPDTQLV-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|