C20H21F3O4 — CID 122649243
[2-[[4-ethyl-5-methyl-2-(trifluoromethyl)phenoxy]methyl]-3-methylphenyl] methyl carbonate (PubChem CID 122649243) has the molecular formula C20H21F3O4 and a molecular weight of 382.38 g/mol. Its IUPAC name is [2-[[4-ethyl-5-methyl-2-(trifluoromethyl)phenoxy]methyl]-3-methylphenyl] methyl carbonate.
| Compound Name | [2-[[4-ethyl-5-methyl-2-(trifluoromethyl)phenoxy]methyl]-3-methylphenyl] methyl carbonate |
|---|---|
| PubChem CID | 122649243 |
| Molecular Formula | C20H21F3O4 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | [2-[[4-ethyl-5-methyl-2-(trifluoromethyl)phenoxy]methyl]-3-methylphenyl] methyl carbonate |
| SMILES | CCc1cc(C(F)(F)F)c(OCc2c(C)cccc2OC(=O)OC)cc1C |
| InChI | InChI=1S/C20H21F3O4/c1-5-14-10-16(20(21,22)23)18(9-13(14)3)26-11-15-12(2)7-6-8-17(15)27-19(24)25-4/h6-10H,5,11H2,1-4H3 |
| InChIKey | ANTDZHWSIJVCFB-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|