C21H23FO4 — CID 122649843
[2-[(2-cyclopropyl-4-ethyl-5-fluorophenoxy)methyl]-3-methylphenyl] methyl carbonate (PubChem CID 122649843) has the molecular formula C21H23FO4 and a molecular weight of 358.41 g/mol. Its IUPAC name is [2-[(2-cyclopropyl-4-ethyl-5-fluorophenoxy)methyl]-3-methylphenyl] methyl carbonate.
| Compound Name | [2-[(2-cyclopropyl-4-ethyl-5-fluorophenoxy)methyl]-3-methylphenyl] methyl carbonate |
|---|---|
| PubChem CID | 122649843 |
| Molecular Formula | C21H23FO4 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | [2-[(2-cyclopropyl-4-ethyl-5-fluorophenoxy)methyl]-3-methylphenyl] methyl carbonate |
| SMILES | CCc1cc(C2CC2)c(OCc2c(C)cccc2OC(=O)OC)cc1F |
| InChI | InChI=1S/C21H23FO4/c1-4-14-10-16(15-8-9-15)20(11-18(14)22)25-12-17-13(2)6-5-7-19(17)26-21(23)24-3/h5-7,10-11,15H,4,8-9,12H2,1-3H3 |
| InChIKey | AYSFJNXNFVPEII-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|