C22H25IO3 — CID 122649884
[2-[(2-cyclopropyl-4-ethyl-5-methylphenoxy)methyl]-3-iodophenyl] propanoate (PubChem CID 122649884) has the molecular formula C22H25IO3 and a molecular weight of 464.34 g/mol. Its IUPAC name is [2-[(2-cyclopropyl-4-ethyl-5-methylphenoxy)methyl]-3-iodophenyl] propanoate.
| Compound Name | [2-[(2-cyclopropyl-4-ethyl-5-methylphenoxy)methyl]-3-iodophenyl] propanoate |
|---|---|
| PubChem CID | 122649884 |
| Molecular Formula | C22H25IO3 |
| Molecular Weight | 464.34 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | [2-[(2-cyclopropyl-4-ethyl-5-methylphenoxy)methyl]-3-iodophenyl] propanoate |
| SMILES | CCC(=O)Oc1cccc(I)c1COc1cc(C)c(CC)cc1C1CC1 |
| InChI | InChI=1S/C22H25IO3/c1-4-15-12-17(16-9-10-16)21(11-14(15)3)25-13-18-19(23)7-6-8-20(18)26-22(24)5-2/h6-8,11-12,16H,4-5,9-10,13H2,1-3H3 |
| InChIKey | IDCISFXLGVBUTK-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.34 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|