C23H28O4 — CID 122646138
[2-[(2-cyclopropyl-4,5-dimethylphenoxy)methyl]-3-ethoxyphenyl] propanoate (PubChem CID 122646138) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is [2-[(2-cyclopropyl-4,5-dimethylphenoxy)methyl]-3-ethoxyphenyl] propanoate.
| Compound Name | [2-[(2-cyclopropyl-4,5-dimethylphenoxy)methyl]-3-ethoxyphenyl] propanoate |
|---|---|
| PubChem CID | 122646138 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | [2-[(2-cyclopropyl-4,5-dimethylphenoxy)methyl]-3-ethoxyphenyl] propanoate |
| SMILES | CCOc1cccc(OC(=O)CC)c1COc1cc(C)c(C)cc1C1CC1 |
| InChI | InChI=1S/C23H28O4/c1-5-23(24)27-21-9-7-8-20(25-6-2)19(21)14-26-22-13-16(4)15(3)12-18(22)17-10-11-17/h7-9,12-13,17H,5-6,10-11,14H2,1-4H3 |
| InChIKey | GSPJBBZHVWDRNG-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|