About [2-[(2-cyclopropyl-4,5-dimethylphenoxy)methyl]-3-(sulfanylmethyl)phenyl] methyl carbonate
[2-[(2-cyclopropyl-4,5-dimethylphenoxy)methyl]-3-(sulfanylmethyl)phenyl] methyl carbonate (PubChem CID 122645764) has the molecular formula C21H24O4S
and a molecular weight of 372.49 g/mol. Its IUPAC name is [2-[(2-cyclopropyl-4,5-dimethylphenoxy)methyl]-3-(sulfanylmethyl)phenyl] methyl carbonate.
Molecular Properties
| Compound Name | [2-[(2-cyclopropyl-4,5-dimethylphenoxy)methyl]-3-(sulfanylmethyl)phenyl] methyl carbonate |
| PubChem CID | 122645764 |
| Molecular Formula | C21H24O4S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | [2-[(2-cyclopropyl-4,5-dimethylphenoxy)methyl]-3-(sulfanylmethyl)phenyl] methyl carbonate |
| SMILES | COC(=O)Oc1cccc(CS)c1COc1cc(C)c(C)cc1C1CC1 |
| InChI | InChI=1S/C21H24O4S/c1-13-9-17(15-7-8-15)20(10-14(13)2)24-11-18-16(12-26)5-4-6-19(18)25-21(22)23-3/h4-6,9-10,15,26H,7-8,11-12H2,1-3H3 |
| InChIKey | IQOYBYMDMGXQKK-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 44.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [2-[(2-cyclopropyl-4,5-dimethylphenoxy)methyl]-3-(sulfanylmethyl)phenyl] methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2-cyclopropyl-4,5-dimethylphenoxy)methyl]-3-(sulfanylmethyl)phenyl] methyl carbonate?
The IUPAC name of [2-[(2-cyclopropyl-4,5-dimethylphenoxy)methyl]-3-(sulfanylmethyl)phenyl] methyl carbonate (CID 122645764) is [2-[(2-cyclopropyl-4,5-dimethylphenoxy)methyl]-3-(sulfanylmethyl)phenyl] methyl carbonate.
What is the SMILES notation for [2-[(2-cyclopropyl-4,5-dimethylphenoxy)methyl]-3-(sulfanylmethyl)phenyl] methyl carbonate?
The canonical SMILES for [2-[(2-cyclopropyl-4,5-dimethylphenoxy)methyl]-3-(sulfanylmethyl)phenyl] methyl carbonate is COC(=O)Oc1cccc(CS)c1COc1cc(C)c(C)cc1C1CC1.
What is the InChIKey of [2-[(2-cyclopropyl-4,5-dimethylphenoxy)methyl]-3-(sulfanylmethyl)phenyl] methyl carbonate?
The InChIKey is IQOYBYMDMGXQKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24O4S/c1-13-9-17(15-7-8-15)20(10-14(13)2)24-11-18-16(12-26)5-4-6-19(18)25-21(22)23-3/h4-6,9-10,15,26H,7-8,11-12H2,1-3H3.
What are the key properties of [2-[(2-cyclopropyl-4,5-dimethylphenoxy)methyl]-3-(sulfanylmethyl)phenyl] methyl carbonate?
[2-[(2-cyclopropyl-4,5-dimethylphenoxy)methyl]-3-(sulfanylmethyl)phenyl] methyl carbonate has a molecular weight of 372.49 g/mol, XLogP of 5.33, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2-cyclopropyl-4,5-dimethylphenoxy)methyl]-3-(sulfanylmethyl)phenyl] methyl carbonate is sourced from PubChem (CID 122645764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).