C18H16ClF3O4S — CID 122645653
[2-[[5-chloro-4-methyl-2-(trifluoromethyl)phenoxy]methyl]-3-(sulfanylmethyl)phenyl] methyl carbonate (PubChem CID 122645653) has the molecular formula C18H16ClF3O4S and a molecular weight of 420.84 g/mol. Its IUPAC name is [2-[[5-chloro-4-methyl-2-(trifluoromethyl)phenoxy]methyl]-3-(sulfanylmethyl)phenyl] methyl carbonate.
| Compound Name | [2-[[5-chloro-4-methyl-2-(trifluoromethyl)phenoxy]methyl]-3-(sulfanylmethyl)phenyl] methyl carbonate |
|---|---|
| PubChem CID | 122645653 |
| Molecular Formula | C18H16ClF3O4S |
| Molecular Weight | 420.84 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | [2-[[5-chloro-4-methyl-2-(trifluoromethyl)phenoxy]methyl]-3-(sulfanylmethyl)phenyl] methyl carbonate |
| SMILES | COC(=O)Oc1cccc(CS)c1COc1cc(Cl)c(C)cc1C(F)(F)F |
| InChI | InChI=1S/C18H16ClF3O4S/c1-10-6-13(18(20,21)22)16(7-14(10)19)25-8-12-11(9-27)4-3-5-15(12)26-17(23)24-2/h3-7,27H,8-9H2,1-2H3 |
| InChIKey | NVCNODDPYOVHKQ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.84 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|