C20H20ClF3O3 — CID 122649601
[2-[[5-chloro-4-ethyl-2-(trifluoromethyl)phenoxy]methyl]-3-methylphenyl] propanoate (PubChem CID 122649601) has the molecular formula C20H20ClF3O3 and a molecular weight of 400.82 g/mol. Its IUPAC name is [2-[[5-chloro-4-ethyl-2-(trifluoromethyl)phenoxy]methyl]-3-methylphenyl] propanoate.
| Compound Name | [2-[[5-chloro-4-ethyl-2-(trifluoromethyl)phenoxy]methyl]-3-methylphenyl] propanoate |
|---|---|
| PubChem CID | 122649601 |
| Molecular Formula | C20H20ClF3O3 |
| Molecular Weight | 400.82 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | [2-[[5-chloro-4-ethyl-2-(trifluoromethyl)phenoxy]methyl]-3-methylphenyl] propanoate |
| SMILES | CCC(=O)Oc1cccc(C)c1COc1cc(Cl)c(CC)cc1C(F)(F)F |
| InChI | InChI=1S/C20H20ClF3O3/c1-4-13-9-15(20(22,23)24)18(10-16(13)21)26-11-14-12(3)7-6-8-17(14)27-19(25)5-2/h6-10H,4-5,11H2,1-3H3 |
| InChIKey | MASSEWFEVADTHH-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.82 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|