C20H22BrClO3 — CID 126604240
[3-bromo-2-[(5-chloro-2,4-diethylphenoxy)methyl]phenyl] propanoate (PubChem CID 126604240) has the molecular formula C20H22BrClO3 and a molecular weight of 425.75 g/mol. Its IUPAC name is [3-bromo-2-[(5-chloro-2,4-diethylphenoxy)methyl]phenyl] propanoate.
| Compound Name | [3-bromo-2-[(5-chloro-2,4-diethylphenoxy)methyl]phenyl] propanoate |
|---|---|
| PubChem CID | 126604240 |
| Molecular Formula | C20H22BrClO3 |
| Molecular Weight | 425.75 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | [3-bromo-2-[(5-chloro-2,4-diethylphenoxy)methyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1cccc(Br)c1COc1cc(Cl)c(CC)cc1CC |
| InChI | InChI=1S/C20H22BrClO3/c1-4-13-10-14(5-2)19(11-17(13)22)24-12-15-16(21)8-7-9-18(15)25-20(23)6-3/h7-11H,4-6,12H2,1-3H3 |
| InChIKey | LFCPFYQFSPBQBH-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.75 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|