C19H17ClF4O3 — CID 122650029
[2-[(5-chloro-4-ethyl-2-fluorophenoxy)methyl]-3-(trifluoromethyl)phenyl] propanoate (PubChem CID 122650029) has the molecular formula C19H17ClF4O3 and a molecular weight of 404.79 g/mol. Its IUPAC name is [2-[(5-chloro-4-ethyl-2-fluorophenoxy)methyl]-3-(trifluoromethyl)phenyl] propanoate.
| Compound Name | [2-[(5-chloro-4-ethyl-2-fluorophenoxy)methyl]-3-(trifluoromethyl)phenyl] propanoate |
|---|---|
| PubChem CID | 122650029 |
| Molecular Formula | C19H17ClF4O3 |
| Molecular Weight | 404.79 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | [2-[(5-chloro-4-ethyl-2-fluorophenoxy)methyl]-3-(trifluoromethyl)phenyl] propanoate |
| SMILES | CCC(=O)Oc1cccc(C(F)(F)F)c1COc1cc(Cl)c(CC)cc1F |
| InChI | InChI=1S/C19H17ClF4O3/c1-3-11-8-15(21)17(9-14(11)20)26-10-12-13(19(22,23)24)6-5-7-16(12)27-18(25)4-2/h5-9H,3-4,10H2,1-2H3 |
| InChIKey | PJQZQHOIBPUYJA-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.79 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|