C17H15Cl2FO3 — CID 122645988
[2-[(2,5-dichloro-4-methylphenoxy)methyl]-3-fluorophenyl] propanoate (PubChem CID 122645988) has the molecular formula C17H15Cl2FO3 and a molecular weight of 357.21 g/mol. Its IUPAC name is [2-[(2,5-dichloro-4-methylphenoxy)methyl]-3-fluorophenyl] propanoate.
| Compound Name | [2-[(2,5-dichloro-4-methylphenoxy)methyl]-3-fluorophenyl] propanoate |
|---|---|
| PubChem CID | 122645988 |
| Molecular Formula | C17H15Cl2FO3 |
| Molecular Weight | 357.21 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | [2-[(2,5-dichloro-4-methylphenoxy)methyl]-3-fluorophenyl] propanoate |
| SMILES | CCC(=O)Oc1cccc(F)c1COc1cc(Cl)c(C)cc1Cl |
| InChI | InChI=1S/C17H15Cl2FO3/c1-3-17(21)23-15-6-4-5-14(20)11(15)9-22-16-8-12(18)10(2)7-13(16)19/h4-8H,3,9H2,1-2H3 |
| InChIKey | IIGROLCADJCESS-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.21 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|