C20H23ClO3S — CID 122649101
[2-[(2-chloro-4-ethyl-5-methylphenoxy)methyl]-3-methylsulfanylphenyl] propanoate (PubChem CID 122649101) has the molecular formula C20H23ClO3S and a molecular weight of 378.92 g/mol. Its IUPAC name is [2-[(2-chloro-4-ethyl-5-methylphenoxy)methyl]-3-methylsulfanylphenyl] propanoate.
| Compound Name | [2-[(2-chloro-4-ethyl-5-methylphenoxy)methyl]-3-methylsulfanylphenyl] propanoate |
|---|---|
| PubChem CID | 122649101 |
| Molecular Formula | C20H23ClO3S |
| Molecular Weight | 378.92 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | [2-[(2-chloro-4-ethyl-5-methylphenoxy)methyl]-3-methylsulfanylphenyl] propanoate |
| SMILES | CCC(=O)Oc1cccc(SC)c1COc1cc(C)c(CC)cc1Cl |
| InChI | InChI=1S/C20H23ClO3S/c1-5-14-11-16(21)18(10-13(14)3)23-12-15-17(24-20(22)6-2)8-7-9-19(15)25-4/h7-11H,5-6,12H2,1-4H3 |
| InChIKey | RUNIQLLPYFLVNT-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.92 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|