C22H26O3S — CID 122626838
[2-[(2-cyclopropyl-4-ethylphenoxy)methyl]-3-methylsulfanylphenyl] propanoate (PubChem CID 122626838) has the molecular formula C22H26O3S and a molecular weight of 370.51 g/mol. Its IUPAC name is [2-[(2-cyclopropyl-4-ethylphenoxy)methyl]-3-methylsulfanylphenyl] propanoate.
| Compound Name | [2-[(2-cyclopropyl-4-ethylphenoxy)methyl]-3-methylsulfanylphenyl] propanoate |
|---|---|
| PubChem CID | 122626838 |
| Molecular Formula | C22H26O3S |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | [2-[(2-cyclopropyl-4-ethylphenoxy)methyl]-3-methylsulfanylphenyl] propanoate |
| SMILES | CCC(=O)Oc1cccc(SC)c1COc1ccc(CC)cc1C1CC1 |
| InChI | InChI=1S/C22H26O3S/c1-4-15-9-12-19(17(13-15)16-10-11-16)24-14-18-20(25-22(23)5-2)7-6-8-21(18)26-3/h6-9,12-13,16H,4-5,10-11,14H2,1-3H3 |
| InChIKey | WOHWQGXNGFBNKT-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|