C21H23ClO3 — CID 122649036
[3-chloro-2-[(2-cyclopropyl-4-ethylphenoxy)methyl]phenyl] propanoate (PubChem CID 122649036) has the molecular formula C21H23ClO3 and a molecular weight of 358.87 g/mol. Its IUPAC name is [3-chloro-2-[(2-cyclopropyl-4-ethylphenoxy)methyl]phenyl] propanoate.
| Compound Name | [3-chloro-2-[(2-cyclopropyl-4-ethylphenoxy)methyl]phenyl] propanoate |
|---|---|
| PubChem CID | 122649036 |
| Molecular Formula | C21H23ClO3 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | [3-chloro-2-[(2-cyclopropyl-4-ethylphenoxy)methyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1cccc(Cl)c1COc1ccc(CC)cc1C1CC1 |
| InChI | InChI=1S/C21H23ClO3/c1-3-14-8-11-19(16(12-14)15-9-10-15)24-13-17-18(22)6-5-7-20(17)25-21(23)4-2/h5-8,11-12,15H,3-4,9-10,13H2,1-2H3 |
| InChIKey | KTQPWOLJIWGODF-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|