C20H21ClO3 — CID 122645858
[3-chloro-2-[(2-cyclopropyl-4-methylphenoxy)methyl]phenyl] propanoate (PubChem CID 122645858) has the molecular formula C20H21ClO3 and a molecular weight of 344.84 g/mol. Its IUPAC name is [3-chloro-2-[(2-cyclopropyl-4-methylphenoxy)methyl]phenyl] propanoate.
| Compound Name | [3-chloro-2-[(2-cyclopropyl-4-methylphenoxy)methyl]phenyl] propanoate |
|---|---|
| PubChem CID | 122645858 |
| Molecular Formula | C20H21ClO3 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | [3-chloro-2-[(2-cyclopropyl-4-methylphenoxy)methyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1cccc(Cl)c1COc1ccc(C)cc1C1CC1 |
| InChI | InChI=1S/C20H21ClO3/c1-3-20(22)24-19-6-4-5-17(21)16(19)12-23-18-10-7-13(2)11-15(18)14-8-9-14/h4-7,10-11,14H,3,8-9,12H2,1-2H3 |
| InChIKey | GWKZSDYXOMXKIU-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|