C19H21ClO4 — CID 126602645
[2-[(5-chloro-2,4-dimethylphenoxy)methyl]-3-(hydroxymethyl)phenyl] propanoate (PubChem CID 126602645) has the molecular formula C19H21ClO4 and a molecular weight of 348.83 g/mol. Its IUPAC name is [2-[(5-chloro-2,4-dimethylphenoxy)methyl]-3-(hydroxymethyl)phenyl] propanoate.
| Compound Name | [2-[(5-chloro-2,4-dimethylphenoxy)methyl]-3-(hydroxymethyl)phenyl] propanoate |
|---|---|
| PubChem CID | 126602645 |
| Molecular Formula | C19H21ClO4 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | [2-[(5-chloro-2,4-dimethylphenoxy)methyl]-3-(hydroxymethyl)phenyl] propanoate |
| SMILES | CCC(=O)Oc1cccc(CO)c1COc1cc(Cl)c(C)cc1C |
| InChI | InChI=1S/C19H21ClO4/c1-4-19(22)24-17-7-5-6-14(10-21)15(17)11-23-18-9-16(20)12(2)8-13(18)3/h5-9,21H,4,10-11H2,1-3H3 |
| InChIKey | ROEHHTWBNVZVEN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|