C18H18ClFO3 — CID 122645889
[2-[(2-chloro-5-fluoro-4-methylphenoxy)methyl]-3-methylphenyl] propanoate (PubChem CID 122645889) has the molecular formula C18H18ClFO3 and a molecular weight of 336.79 g/mol. Its IUPAC name is [2-[(2-chloro-5-fluoro-4-methylphenoxy)methyl]-3-methylphenyl] propanoate.
| Compound Name | [2-[(2-chloro-5-fluoro-4-methylphenoxy)methyl]-3-methylphenyl] propanoate |
|---|---|
| PubChem CID | 122645889 |
| Molecular Formula | C18H18ClFO3 |
| Molecular Weight | 336.79 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | [2-[(2-chloro-5-fluoro-4-methylphenoxy)methyl]-3-methylphenyl] propanoate |
| SMILES | CCC(=O)Oc1cccc(C)c1COc1cc(F)c(C)cc1Cl |
| InChI | InChI=1S/C18H18ClFO3/c1-4-18(21)23-16-7-5-6-11(2)13(16)10-22-17-9-15(20)12(3)8-14(17)19/h5-9H,4,10H2,1-3H3 |
| InChIKey | NIMUAFFMQPEJRL-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.79 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|