C20H21ClF2O3 — CID 122626539
[2-[[5-chloro-2-(difluoromethyl)-4-ethylphenoxy]methyl]-3-methylphenyl] propanoate (PubChem CID 122626539) has the molecular formula C20H21ClF2O3 and a molecular weight of 382.83 g/mol. Its IUPAC name is [2-[[5-chloro-2-(difluoromethyl)-4-ethylphenoxy]methyl]-3-methylphenyl] propanoate.
| Compound Name | [2-[[5-chloro-2-(difluoromethyl)-4-ethylphenoxy]methyl]-3-methylphenyl] propanoate |
|---|---|
| PubChem CID | 122626539 |
| Molecular Formula | C20H21ClF2O3 |
| Molecular Weight | 382.83 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | [2-[[5-chloro-2-(difluoromethyl)-4-ethylphenoxy]methyl]-3-methylphenyl] propanoate |
| SMILES | CCC(=O)Oc1cccc(C)c1COc1cc(Cl)c(CC)cc1C(F)F |
| InChI | InChI=1S/C20H21ClF2O3/c1-4-13-9-14(20(22)23)18(10-16(13)21)25-11-15-12(3)7-6-8-17(15)26-19(24)5-2/h6-10,20H,4-5,11H2,1-3H3 |
| InChIKey | VVYVOORXASBOLF-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.83 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|