C20H21F3O3 — CID 122649443
[2-[(4-ethyl-2-methylphenoxy)methyl]-3-(trifluoromethyl)phenyl] propanoate (PubChem CID 122649443) has the molecular formula C20H21F3O3 and a molecular weight of 366.38 g/mol. Its IUPAC name is [2-[(4-ethyl-2-methylphenoxy)methyl]-3-(trifluoromethyl)phenyl] propanoate.
| Compound Name | [2-[(4-ethyl-2-methylphenoxy)methyl]-3-(trifluoromethyl)phenyl] propanoate |
|---|---|
| PubChem CID | 122649443 |
| Molecular Formula | C20H21F3O3 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | [2-[(4-ethyl-2-methylphenoxy)methyl]-3-(trifluoromethyl)phenyl] propanoate |
| SMILES | CCC(=O)Oc1cccc(C(F)(F)F)c1COc1ccc(CC)cc1C |
| InChI | InChI=1S/C20H21F3O3/c1-4-14-9-10-17(13(3)11-14)25-12-15-16(20(21,22)23)7-6-8-18(15)26-19(24)5-2/h6-11H,4-5,12H2,1-3H3 |
| InChIKey | JOBUMYSNOUWKBL-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|