C19H19F3N2O3 — CID 122626732
[2-[(4-ethyl-2-methylphenoxy)methyl]-3-(trifluoromethyl)phenyl] N-methyliminocarbamate (PubChem CID 122626732) has the molecular formula C19H19F3N2O3 and a molecular weight of 380.37 g/mol. Its IUPAC name is [2-[(4-ethyl-2-methylphenoxy)methyl]-3-(trifluoromethyl)phenyl] N-methyliminocarbamate.
| Compound Name | [2-[(4-ethyl-2-methylphenoxy)methyl]-3-(trifluoromethyl)phenyl] N-methyliminocarbamate |
|---|---|
| PubChem CID | 122626732 |
| Molecular Formula | C19H19F3N2O3 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | [2-[(4-ethyl-2-methylphenoxy)methyl]-3-(trifluoromethyl)phenyl] N-methyliminocarbamate |
| SMILES | CCc1ccc(OCc2c(OC(=O)/N=N/C)cccc2C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C19H19F3N2O3/c1-4-13-8-9-16(12(2)10-13)26-11-14-15(19(20,21)22)6-5-7-17(14)27-18(25)24-23-3/h5-10H,4,11H2,1-3H3/b24-23+ |
| InChIKey | DKUFKBPXXZBMET-WCWDXBQESA-N |
| XLogP | 5.74 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|