C19H22O3S — CID 122626551
[2-[(4-ethyl-2-methylphenoxy)methyl]-3-methylphenyl] methylsulfanylformate (PubChem CID 122626551) has the molecular formula C19H22O3S and a molecular weight of 330.45 g/mol. Its IUPAC name is [2-[(4-ethyl-2-methylphenoxy)methyl]-3-methylphenyl] methylsulfanylformate.
| Compound Name | [2-[(4-ethyl-2-methylphenoxy)methyl]-3-methylphenyl] methylsulfanylformate |
|---|---|
| PubChem CID | 122626551 |
| Molecular Formula | C19H22O3S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | [2-[(4-ethyl-2-methylphenoxy)methyl]-3-methylphenyl] methylsulfanylformate |
| SMILES | CCc1ccc(OCc2c(C)cccc2OC(=O)SC)c(C)c1 |
| InChI | InChI=1S/C19H22O3S/c1-5-15-9-10-17(14(3)11-15)21-12-16-13(2)7-6-8-18(16)22-19(20)23-4/h6-11H,5,12H2,1-4H3 |
| InChIKey | SJLZYWDKYDZRTK-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|