C20H25NO2S — CID 126587870
S-methyl N-[2-[(4-ethyl-2-methylphenoxy)methyl]-3-methylphenyl]-N-methylcarbamothioate (PubChem CID 126587870) has the molecular formula C20H25NO2S and a molecular weight of 343.49 g/mol. Its IUPAC name is S-methyl N-[2-[(4-ethyl-2-methylphenoxy)methyl]-3-methylphenyl]-N-methylcarbamothioate.
| Compound Name | S-methyl N-[2-[(4-ethyl-2-methylphenoxy)methyl]-3-methylphenyl]-N-methylcarbamothioate |
|---|---|
| PubChem CID | 126587870 |
| Molecular Formula | C20H25NO2S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | S-methyl N-[2-[(4-ethyl-2-methylphenoxy)methyl]-3-methylphenyl]-N-methylcarbamothioate |
| SMILES | CCc1ccc(OCc2c(C)cccc2N(C)C(=O)SC)c(C)c1 |
| InChI | InChI=1S/C20H25NO2S/c1-6-16-10-11-19(15(3)12-16)23-13-17-14(2)8-7-9-18(17)21(4)20(22)24-5/h7-12H,6,13H2,1-5H3 |
| InChIKey | VXHNHHPTYAVGGA-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|