C21H26O3S — CID 122626724
S-methyl 3-[2-[(4-ethyl-2-methylphenoxy)methyl]-3-methoxyphenyl]propanethioate (PubChem CID 122626724) has the molecular formula C21H26O3S and a molecular weight of 358.50 g/mol. Its IUPAC name is S-methyl 3-[2-[(4-ethyl-2-methylphenoxy)methyl]-3-methoxyphenyl]propanethioate.
| Compound Name | S-methyl 3-[2-[(4-ethyl-2-methylphenoxy)methyl]-3-methoxyphenyl]propanethioate |
|---|---|
| PubChem CID | 122626724 |
| Molecular Formula | C21H26O3S |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | S-methyl 3-[2-[(4-ethyl-2-methylphenoxy)methyl]-3-methoxyphenyl]propanethioate |
| SMILES | CCc1ccc(OCc2c(CCC(=O)SC)cccc2OC)c(C)c1 |
| InChI | InChI=1S/C21H26O3S/c1-5-16-9-11-19(15(2)13-16)24-14-18-17(10-12-21(22)25-4)7-6-8-20(18)23-3/h6-9,11,13H,5,10,12,14H2,1-4H3 |
| InChIKey | QXKJHJNFKSVBJX-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|