C19H19F3O3 — CID 122650109
[2-[(4-ethyl-2-methylphenoxy)methyl]-3-(trifluoromethyl)phenyl] acetate (PubChem CID 122650109) has the molecular formula C19H19F3O3 and a molecular weight of 352.35 g/mol. Its IUPAC name is [2-[(4-ethyl-2-methylphenoxy)methyl]-3-(trifluoromethyl)phenyl] acetate.
| Compound Name | [2-[(4-ethyl-2-methylphenoxy)methyl]-3-(trifluoromethyl)phenyl] acetate |
|---|---|
| PubChem CID | 122650109 |
| Molecular Formula | C19H19F3O3 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | [2-[(4-ethyl-2-methylphenoxy)methyl]-3-(trifluoromethyl)phenyl] acetate |
| SMILES | CCc1ccc(OCc2c(OC(C)=O)cccc2C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C19H19F3O3/c1-4-14-8-9-17(12(2)10-14)24-11-15-16(19(20,21)22)6-5-7-18(15)25-13(3)23/h5-10H,4,11H2,1-3H3 |
| InChIKey | MLBOTGBZYHRLJC-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|