C19H20F3NO2S — CID 122649109
S-[2-[(4-ethyl-2-methylphenoxy)methyl]-3-(trifluoromethyl)phenyl] N-methylcarbamothioate (PubChem CID 122649109) has the molecular formula C19H20F3NO2S and a molecular weight of 383.44 g/mol. Its IUPAC name is S-[2-[(4-ethyl-2-methylphenoxy)methyl]-3-(trifluoromethyl)phenyl] N-methylcarbamothioate.
| Compound Name | S-[2-[(4-ethyl-2-methylphenoxy)methyl]-3-(trifluoromethyl)phenyl] N-methylcarbamothioate |
|---|---|
| PubChem CID | 122649109 |
| Molecular Formula | C19H20F3NO2S |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | S-[2-[(4-ethyl-2-methylphenoxy)methyl]-3-(trifluoromethyl)phenyl] N-methylcarbamothioate |
| SMILES | CCc1ccc(OCc2c(SC(=O)NC)cccc2C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C19H20F3NO2S/c1-4-13-8-9-16(12(2)10-13)25-11-14-15(19(20,21)22)6-5-7-17(14)26-18(24)23-3/h5-10H,4,11H2,1-3H3,(H,23,24) |
| InChIKey | BTIPNXJMVCBMBL-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|