C18H19ClO2S — CID 122650100
S-[3-chloro-2-[(4-ethyl-2-methylphenoxy)methyl]phenyl] ethanethioate (PubChem CID 122650100) has the molecular formula C18H19ClO2S and a molecular weight of 334.87 g/mol. Its IUPAC name is S-[3-chloro-2-[(4-ethyl-2-methylphenoxy)methyl]phenyl] ethanethioate.
| Compound Name | S-[3-chloro-2-[(4-ethyl-2-methylphenoxy)methyl]phenyl] ethanethioate |
|---|---|
| PubChem CID | 122650100 |
| Molecular Formula | C18H19ClO2S |
| Molecular Weight | 334.87 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | S-[3-chloro-2-[(4-ethyl-2-methylphenoxy)methyl]phenyl] ethanethioate |
| SMILES | CCc1ccc(OCc2c(Cl)cccc2SC(C)=O)c(C)c1 |
| InChI | InChI=1S/C18H19ClO2S/c1-4-14-8-9-17(12(2)10-14)21-11-15-16(19)6-5-7-18(15)22-13(3)20/h5-10H,4,11H2,1-3H3 |
| InChIKey | XXJMMDHUTPVSLI-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.87 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|