C18H20ClNO2S — CID 122646314
S-[3-chloro-2-[(2,4,5-trimethylphenoxy)methyl]phenyl] N-methylcarbamothioate (PubChem CID 122646314) has the molecular formula C18H20ClNO2S and a molecular weight of 349.88 g/mol. Its IUPAC name is S-[3-chloro-2-[(2,4,5-trimethylphenoxy)methyl]phenyl] N-methylcarbamothioate.
| Compound Name | S-[3-chloro-2-[(2,4,5-trimethylphenoxy)methyl]phenyl] N-methylcarbamothioate |
|---|---|
| PubChem CID | 122646314 |
| Molecular Formula | C18H20ClNO2S |
| Molecular Weight | 349.88 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | S-[3-chloro-2-[(2,4,5-trimethylphenoxy)methyl]phenyl] N-methylcarbamothioate |
| SMILES | CNC(=O)Sc1cccc(Cl)c1COc1cc(C)c(C)cc1C |
| InChI | InChI=1S/C18H20ClNO2S/c1-11-8-13(3)16(9-12(11)2)22-10-14-15(19)6-5-7-17(14)23-18(21)20-4/h5-9H,10H2,1-4H3,(H,20,21) |
| InChIKey | YZNVPTFZCRFVMP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.88 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|