C21H26O2S — CID 122649579
S-[3-ethyl-2-[(4-ethyl-2,5-dimethylphenoxy)methyl]phenyl] ethanethioate (PubChem CID 122649579) has the molecular formula C21H26O2S and a molecular weight of 342.50 g/mol. Its IUPAC name is S-[3-ethyl-2-[(4-ethyl-2,5-dimethylphenoxy)methyl]phenyl] ethanethioate.
| Compound Name | S-[3-ethyl-2-[(4-ethyl-2,5-dimethylphenoxy)methyl]phenyl] ethanethioate |
|---|---|
| PubChem CID | 122649579 |
| Molecular Formula | C21H26O2S |
| Molecular Weight | 342.50 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | S-[3-ethyl-2-[(4-ethyl-2,5-dimethylphenoxy)methyl]phenyl] ethanethioate |
| SMILES | CCc1cc(C)c(OCc2c(CC)cccc2SC(C)=O)cc1C |
| InChI | InChI=1S/C21H26O2S/c1-6-17-9-8-10-21(24-16(5)22)19(17)13-23-20-12-14(3)18(7-2)11-15(20)4/h8-12H,6-7,13H2,1-5H3 |
| InChIKey | OWEZGGTZGUDYMM-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.50 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|