C23H31NOS — CID 122626856
3-[3-ethyl-2-[(4-ethyl-2,5-dimethylphenoxy)methyl]phenyl]-N-methylpropanethioamide (PubChem CID 122626856) has the molecular formula C23H31NOS and a molecular weight of 369.57 g/mol. Its IUPAC name is 3-[3-ethyl-2-[(4-ethyl-2,5-dimethylphenoxy)methyl]phenyl]-N-methylpropanethioamide.
| Compound Name | 3-[3-ethyl-2-[(4-ethyl-2,5-dimethylphenoxy)methyl]phenyl]-N-methylpropanethioamide |
|---|---|
| PubChem CID | 122626856 |
| Molecular Formula | C23H31NOS |
| Molecular Weight | 369.57 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 3-[3-ethyl-2-[(4-ethyl-2,5-dimethylphenoxy)methyl]phenyl]-N-methylpropanethioamide |
| SMILES | CCc1cc(C)c(OCc2c(CC)cccc2CCC(=S)NC)cc1C |
| InChI | InChI=1S/C23H31NOS/c1-6-18-9-8-10-20(11-12-23(26)24-5)21(18)15-25-22-14-16(3)19(7-2)13-17(22)4/h8-10,13-14H,6-7,11-12,15H2,1-5H3,(H,24,26) |
| InChIKey | HTRGAZGRLDZGMZ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.57 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|