C22H27BrO2S — CID 122626782
O-methyl 3-[3-bromo-2-[(4,5-diethyl-2-methylphenoxy)methyl]phenyl]propanethioate (PubChem CID 122626782) has the molecular formula C22H27BrO2S and a molecular weight of 435.43 g/mol. Its IUPAC name is O-methyl 3-[3-bromo-2-[(4,5-diethyl-2-methylphenoxy)methyl]phenyl]propanethioate.
| Compound Name | O-methyl 3-[3-bromo-2-[(4,5-diethyl-2-methylphenoxy)methyl]phenyl]propanethioate |
|---|---|
| PubChem CID | 122626782 |
| Molecular Formula | C22H27BrO2S |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | O-methyl 3-[3-bromo-2-[(4,5-diethyl-2-methylphenoxy)methyl]phenyl]propanethioate |
| SMILES | CCc1cc(C)c(OCc2c(Br)cccc2CCC(=S)OC)cc1CC |
| InChI | InChI=1S/C22H27BrO2S/c1-5-16-12-15(3)21(13-17(16)6-2)25-14-19-18(8-7-9-20(19)23)10-11-22(26)24-4/h7-9,12-13H,5-6,10-11,14H2,1-4H3 |
| InChIKey | DANPWXUOLLGKQN-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|