C18H20BrNO2S — CID 122646306
O-[3-bromo-2-[(2,4,5-trimethylphenoxy)methyl]phenyl] N-methylcarbamothioate (PubChem CID 122646306) has the molecular formula C18H20BrNO2S and a molecular weight of 394.33 g/mol. Its IUPAC name is O-[3-bromo-2-[(2,4,5-trimethylphenoxy)methyl]phenyl] N-methylcarbamothioate.
| Compound Name | O-[3-bromo-2-[(2,4,5-trimethylphenoxy)methyl]phenyl] N-methylcarbamothioate |
|---|---|
| PubChem CID | 122646306 |
| Molecular Formula | C18H20BrNO2S |
| Molecular Weight | 394.33 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | O-[3-bromo-2-[(2,4,5-trimethylphenoxy)methyl]phenyl] N-methylcarbamothioate |
| SMILES | CNC(=S)Oc1cccc(Br)c1COc1cc(C)c(C)cc1C |
| InChI | InChI=1S/C18H20BrNO2S/c1-11-8-13(3)17(9-12(11)2)21-10-14-15(19)6-5-7-16(14)22-18(23)20-4/h5-9H,10H2,1-4H3,(H,20,23) |
| InChIKey | YUNORZMYTYVPAD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.33 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|